Solveeit Logo

Question

Question: Which is the major product of the following reaction? \( CH_3-C\left( =O \right)-Cl+\xrightarrow...

Which is the major product of the following reaction?
CH3C(=O)Cl+H2SProductCH_3-C\left( =O \right)-Cl+\xrightarrow{{{H}_{2}}S}Product
(A) CH3(SH)C(OH)ClCH_3-(SH)C(OH)-Cl
(B) CH3C(=O)SHCH_3-C(=O)-SH
(C) CH3C(=S)ClCH_3-C(=S)-Cl
(D) CH3C(=O)SC(=O)CH3C{{H}_{3}}-C(=O)-S-C(=O)-C{{H}_{3}}

Explanation

Solution

We know that the reactant has the functional group of hydrogen sulfide. The molecular formula of acetyl chloride is CH3COClC{{H}_{3}}COCl . The product formed will contain a carbonyl group. In organic chemistry, acetyl groups are represented by CH3COC{{H}_{3}}CO . Acetyl chloride is also called acyl chloride.

Complete step by step solution:
Acetyl chloride is a colourless and volatile liquid. The prominent use of acetyl chloride is for introducing acetyl groups. In order to prepare esters and amides of acetic acid, acetyl chloride is used as a reagent. Hydrogen sulfide is an organic chemical compound which is also known as spirit, drinking hydrogen sulfide and grain hydrogen sulfide.
It is a flammable volatile and colourless liquid. Also, it has a slight characteristic odour. There are various ways to produce hydrogen sulfide. Naturally, it is produced by fermentation of sugar by yeast or through petrochemical processes such as ethylene hydration. The reaction that takes places between hydrogen sulfide and acetyl chloride is as follows:
CH3C(=O)Cl+H2SCH3C(=O)SHCH_3-C\left( =O \right)-Cl+\xrightarrow{{{H}_{2}}S}CH_3-C(=O)-SH
The reactants are ethyl alcohol and acetyl chloride respectively. The product obtained is ethyl acetate which is an ester. Hence this reaction is known as esterification.
Therefore, the correct answer is option B.

Note:
Remember that Ethyl Acetate can also be prepared with hydrogen sulfide and acetic acid. The other use of ethyl acetate is that it is used as a solvent for column and thin-layer chromatography. Esterification is the general name for the chemical reaction in which ester is formed as a product and the reactants generally used are acid and hydrogen sulfide or acyl chloride and hydrogen sulfide.