Question
Question: When propanal reacts with 2-methylpropanal in presence of \(NaOH\), four different products are form...
When propanal reacts with 2-methylpropanal in presence of NaOH, four different products are formed. The reaction is known as
(A) Aldol condensation
(B) Cross aldol condensation
(C) Cannizzaro reaction
(D) HVZ reaction
Solution
Whenever an aldehyde reacts with itself or some other aldehyde, in presence of NaOH, the reaction is aldol condensation. It can be cross aldol condensation if two different aldehydes react in the same reaction and in cross aldol condensation, four products are formed.
Complete step by step answer:
When two molecules of aldehyde containing α- hydrogen or two molecules of ketones are reacted with aqueous or alcoholic alkali undergoes condensation reaction to give β- hydroxy aldehyde (aldol) or β- hydroxyl ketone (ketol).
And, when two different molecules of aldehydes or ketones are involved then such condensation is called crossed aldol condensation.
α- hydrogen is the hydrogen atom attached to the α- carbon i.e. the carbon atom next to the functional group.
The reaction between propanal and 2-methyl propanal is given as follows –
{C_2}{H_5}CHO + {C_3}{H_7}CHO\xrightarrow{{NaOH}}C{H_2}\left( {C{H_3}} \right)\left( {CHO} \right)CH\left( {OH} \right){C_2}{H_5} + C{\left( {C{H_3}} \right)_2}\left( {CHO} \right)CH\left( {OH} \right)CH{\left( {C{H_3}} \right)_2}$$$$ + CH{\left( {C{H_3}} \right)_2}\left( {CHO} \right)CH\left( {OH} \right){C_2}{H_5} + C{H_2}\left( {C{H_3}} \right)\left( {CHO} \right)CH\left( {OH} \right)CH{\left( {C{H_3}} \right)_2}
Here , the 4 products are 2-Methyl-3-hydroxypentanal , 2,2,4-Trimethyl-3-hydroxypentanal ,
2,2-Dimethyl-3-hydroxypentanal , 2,4-Dimethyl-3-hydroxypentanal .
Among these, the two products formed are due to aldol condensation between the same aldehyde and the other two due to aldol condensation between different aldehydes.
Now we consider the reactions between the aldehydes forming 4 different products.
Let's denote propanal as A1 and 2-methyl propanal as A2
A1→A1
C2H5CHO+C2H5CHO→CH2(CH3)(CHO)CH(OH)C2H5
A2→A2
C3H7CHO+C3H7CHO→C(CH3)2(CHO)CH(OH)CH(CH3)2
A1→A2
C2H5CHO+C3H7CHO→CH(CH3)2(CHO)CH(OH)C2H5
A2→A1
C3H7CHO+C2H5CHO→CH2(CH3)(CHO)CH(OH)CH(CH3)2
When two molecules of aldehyde not containing α- hydrogen is reacted with 50 % alkalies undergo oxidation-reduction disproportionate to give corresponding alcohols and salts of carboxylic acid. This reaction is called Cannizzaro's reaction.
But here, both the reactant molecules have α- hydrogen, so Cannizzaro reaction is not possible.
Hence, the reaction is cross aldol condensation.
So, the correct answer is Option B .
Note: In the mechanism of aldol condensation, the second aldehyde molecule’s α- hydrogen gets attached to the first aldehyde molecule’s β hydrogen.
β-hydrogen is the hydrogen atom attached to the β carbon i.e. to the carbon atom next to α carbon.
Enolate ion is formed from the carbonyl carbon