Solveeit Logo

Question

Question: What is Z in the following reaction sequence? \[{{C}_{6}}{{H}_{5}}N{{H}_{2}}\xrightarrow[(ii){{H}_...

What is Z in the following reaction sequence?
C6H5NH2(ii)H3PO2+H2O(iii)CO;anhydrousAlCl3/CuCl(i)NaNO2/HCl,273KZ{{C}_{6}}{{H}_{5}}N{{H}_{2}}\xrightarrow[(ii){{H}_{3}}P{{O}_{2}}+{{H}_{2}}O(iii)CO;anhydrousAlC{{l}_{3}}/CuCl]{(i)NaN{{O}_{2}}/HCl,273K}Z
A)C6H5CO2H{{C}_{6}}{{H}_{5}}C{{O}_{2}}H
B)C6H5OH{{C}_{6}}{{H}_{5}}OH
C)C6H5CHO{{C}_{6}}{{H}_{5}}CHO
D)C6H6{{C}_{6}}{{H}_{6}}

Explanation

Solution

The answer to this question lies in the basic concepts of organic chemistry which includes the fact that sodium nitrite yields diazonium salt and undergoes reduction when treated with hypophosphorous acid followed by subsequent formylation.

Complete answer:
In our organic chemistry classes, we have studied about the basic reactions that involve several named reactions as well as oxidation, reduction, substitution etc., reactions.
Let us now see the types of reaction aniline undergoes when subjected to subsequent reagents one by one.
- Aniline when treated with sodium nitrite in presence of hydrochloric acid in cold condition yields the diazonium salt because there is nitration occurring.
Further this diazonium salt produced is subjected to the treatment with hypophosphorous acid that is H3PO2{{H}_{3}}P{{O}_{2}} which is basically a reducing agent, reduces the salt with the elimination of amino groups and thus addition of hydrogen occurs by hydrolysis.
The product obtained is benzene and this is further treated with the carbon monoxide in the presence of aluminium chloride and copper chloride converts it into benzaldehyde. This reaction is called Gatterman Koch reaction used for formylation of aromatic compounds.
The overall reaction is as shown below,

Thus, the correct answer is option C) C6H5CHO{{C}_{6}}{{H}_{5}}CHO

Note: The main point to be noted here is that nitration doesn’t always means reaction of sulphuric and nitric acid but it is the addition of nitronium ion and is valid to any reagent which are capable to produce this ion based on the reaction conditions and also type of reactant used.