Solveeit Logo

Question

Question: The value of enthalpy change (\(\Delta H\)) for the reaction \[{C_2}{H_5}OH(l) + 3{O_2}(g) \to 2C{O_...

The value of enthalpy change (ΔH\Delta H) for the reaction C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l){C_2}{H_5}OH(l) + 3{O_2}(g) \to 2C{O_2}(g) + 3{H_2}O(l), at 27C27^\circ C is 1366.5kJ  mol1 - 1366.5{{ }}kJ\;mo{l^{ - 1}}. The value of internal energy change for the above reaction at this temperature will be:
A. 1371.5kJ - 1371.5kJ
B. 1369.0kJ - 1369.0kJ
C. 1364.0kJ - 1364.0kJ
D. 1361.5kJ - 1361.5kJ

Explanation

Solution

As the enthalpy change is given to us and the temperature doesn’t change, by assuming that the reaction occurs at constant pressure we can use the ideal gas relation in the equation relating enthalpy and internal energy.
Formulas used:
ΔH=ΔU+PΔV\Delta H = \Delta U + P\Delta V
Where ΔH\Delta H is the enthalpy change, ΔU\Delta U is the change in internal energy, PP is the pressure, ΔV\Delta V is the change in volume.
PV=nRTPV = nRT
Where PP is the pressure, VV is the volume, nn is the number of moles, RR is the universal gas constant and TT is the absolute temperature.
ΔH=ΔU+ΔngRT\Delta H = \Delta U + \Delta {n_g}RT
Where Δng\Delta {n_g} is the change in number of moles in gaseous phase, and the rest of the terms are the same as that defined above.

Complete step by step answer:
As we know, enthalpy and internal energy are related by the equation:
ΔH=ΔU+PΔV\Delta H = \Delta U + P\Delta V
Where ΔH\Delta H is the enthalpy change, ΔU\Delta U is the change in internal energy, PP is the pressure, ΔV\Delta V is the change in volume.
From the ideal gas equation, we have:
PV=nRTPV = nRT
Where PP is the pressure, VV is the volume, nn is the number of moles, RR is the universal gas constant and TT is the absolute temperature.
In this case, as pressure is assumed to be constant and so is the temperature, the only quantities which change before and after the reaction are volume and number of moles. Therefore, the equation reduces to:
PΔV=ΔngRTP\Delta V = \Delta {n_g}RT
Where, ΔV\Delta V is the change in volume and Δng\Delta {n_g} is the change in number of moles in gaseous phase
Substituting this in our equation for enthalpy, we get:
ΔH=ΔU+ΔngRTΔU=ΔHΔngRT\Delta H = \Delta U + \Delta {n_g}RT \Rightarrow \Delta U = \Delta H - \Delta {n_g}RT
In this reaction, there are two components present in the gaseous phase, namely, oxygen and carbon dioxide, on the reactant and product side respectively. Three moles of oxygen are present in the reactant side while one mole of carbon dioxide is present in the product side.
Therefore, the change in number of moles in gaseous phase:
Δng=23=1\Delta {n_g} = 2 - 3 = - 1
We know R=8.314J/mol.KR = 8.314J/mol.K and by converting temperature from degree Celsius to Kelvin by adding 273, we have:
T=27+273=300KT = 27 + 273 = 300K
Substituting these values into the equation ΔU=ΔHΔngRT\Delta U = \Delta H - \Delta {n_g}RT, we have:
ΔU=1366.5+(1×8.314×300)\Delta U = - 1366.5 + ( - 1 \times 8.314 \times 300)
On solving, we get:
ΔU=1364000J=1364.0kJ\Delta U = - 1364000J = - 1364.0kJ
Hence, the correct option is C.

Note:
Note that we are only required to calculate the change in number of moles in the gaseous phase, and not for the entire reaction.
Also the equations we derived here are a direct consequence of the First Law of Thermodynamics, which states that the heat supplied/released in a reaction is equal to the sum of change in internal energy and work done by/on the gas. In this case, as the temperature and pressure are kept constant, the heat released is equal to the enthalpy change.