Solveeit Logo

Question

Question: The compound 'X' reacts with ammoniacal \[AgN{O_3}\] to give a white precipitate and on oxidation wi...

The compound 'X' reacts with ammoniacal AgNO3AgN{O_3} to give a white precipitate and on oxidation with hot alkaline KMnO4KMn{O_4} gives the acid (CH3)2CHCOOH{(C{H_3})_2}CHCOOH . Therefore, ' XX ' is:
A.CH2=CHCH=CHCH2C{H_2} = CH - CH = CH - C{H_2}
B.CH3(CH2)2CCHC{H_3}{(C{H_2})_2}C \equiv CH
C.(CH3)2CHCCH{(C{H_3})_2}CH - C \equiv CH
D.(CH3)2C=C=CH2{(C{H_3})_2}C = C = C{H_2}

Explanation

Solution

In the given question firstly we have to get the condition for both the reactions that are performed in the question and when we will get that we just have to apply the conditions in order to get the reaction and then we can get the correct answer for the given problem. Like for the reaction with the ammonical AgNO3AgN{O_3} , the reaction would be CH3(CH2)2CCHwhite precipitateC{H_3}{(C{H_2})_2}C \equiv CH \to white{\text{ }}precipitate .

Complete step by step answer:
Here according to the question statement we get that the supposed compound ' XX ' in the problem have subsequent reaction that gives a specific kind of products under the given conditions :
-The compound it reacts to is : AgNO3AgN{O_3} also categorized as the tollens reagent in organic chemistry.
-The colour of the precipitate obtained in the process of this reaction is : White
-The product obtained when this same compound is oxidised in the presence of hot alkaline KMnO4KMn{O_4} : the carboxylic acid (CH3)2CHCOOH{(C{H_3})_2}CHCOOH
In the question we can see and observe that there is the presence of the two reactions of the same compound in the two different cases. So we have to take them case wise :
Case 1 : In this situation there is the reaction of the compound XX with the AgNO3AgN{O_3}
So the reaction for the given reaction would be :
CH3(CH2)2CCHwhite precipitateC{H_3}{(C{H_2})_2}C \equiv CH \to white{\text{ }}precipitate under the presence of the AgNO3AgN{O_3}
As the generation of the white precipitate gives the output that the given compound should have an unsaturated triple bond.
Case 2 : In this situation there is the reaction of the compound XX is in the presence of hot alkaline KMnO4KMn{O_4}
So the reaction for the given reaction would be :
CH3(CH2)2CCH(CH3)2CHCOOHC{H_3}{(C{H_2})_2}C \equiv CH \to {(C{H_3})_2}CH COOH oxidation under the presence of the hot alkaline KMnO4KMn{O_4}
So we can clearly say that the correct option would be option C, (CH3)2CHCCH{(C{H_3})_2}CH - C \equiv CH.

Note:
Tollens' reagent is a chemical reagent used to determine the presence of aldehyde and aromatic aldehyde functional groups along with some alpha-hydroxy ketone which can tautomerize into aldehyde. The reagent consists of a solution of silver nitrate, ammonia and some sodium hydroxide.