Question
Question: Find the value of \[\sin {{135}^{\circ }}\]....
Find the value of sin135∘.
Solution
Hint: In this question, we first need to write 135∘ as the sum of the known angles and convert it accordingly by using the trigonometric ratios of compound angles formula. Then we can get the value from the trigonometric ratios of some standard angles.
Complete step-by-step answer:
Trigonometric Ratios:
Relations between different sides and angles of a right angles triangle are called trigonometric ratios.
Trigonometric Ratios of Allied Angles:
Two angles are said to be allied when their sum or difference is either zero or a multiple of 90∘. The angles −θ,90∘±θ,180∘±θ,270∘±θ,360∘−θ etc. are angles allied to the angle θ
if θ is measured in degrees.
Trigonometric Ratios of Compound Angles:
The algebraic sum of two or more angles are generally called compound angles.
Some standard formula of compound angles can be given by
sin(A+B)=sinAcosB+cosAsinB
Trigonometric ratios of some standard angles are
