Solveeit Logo

Question

Question: Find B of the given reaction \[{\text{H}} - {\text{C}} \equiv {\text{C}} - {\text{H}}\dfrac{{{\tex...

Find B of the given reaction
HCCHHgSO4H2SO4(  A)(1)NH3+HCNH3O+(B){\text{H}} - {\text{C}} \equiv {\text{C}} - {\text{H}}\dfrac{{{\text{HgS}}{{\text{O}}_4}}}{{{{\text{H}}_2}{\text{S}}{{\text{O}}_4}}}(\;{\text{A}})\dfrac{{(1){\text{N}}{{\text{H}}_3} + {\text{HCN}}}}{{{H_3}{O^ + }}}({\text{B}})
A.Glycine
B.Alanine
C.Valine
D.Leucine

Explanation

Solution

Proteins are made up of amino acids, which are chemical molecules that bind to form proteins. The building blocks of life are amino acids and proteins. Amino acids are left over after proteins are digested or broken down. Amino acids are used by the human body to produce proteins that aid in the following functions: Break down food. Carbon, hydrogen, oxygen, and nitrogen are the four essential elements of an amino acid, while other elements can be present in the side chains of certain amino acids.

Complete answer: A hydration reaction is a chemical reaction that occurs when a compound reacts with water. Water is applied to an unsaturated base in organic chemistry, which is typically an alkene or an alkyne.
HCCH+H2OH2SO4HgSO4HCH=CHOH tautomerization CH3CHO{\mathbf{H}} - {\mathbf{C}} \equiv {\mathbf{C}} - {\mathbf{H}} + {{\mathbf{H}}_2}{\text{O}}\xrightarrow[{{{\text{H}}_2}{\text{S}}{{\text{O}}_4}}]{{{\text{HgS}}{{\text{O}}_4}}}{\mathbf{H}} - {\mathbf{CH}} = {\mathbf{CH}} - {\text{OH}}\mathop {\xrightarrow{{{\text{ tautomerization }}}}}\limits^{} {\mathbf{C}}{{\mathbf{H}}_3} - {\mathbf{CHO}}
Ethyne reacts with sulphuric acid to get ethanal.
Tautomerism is a condition in which a single chemical element exists in two or more interconvertible systems of varying relative positions of one atomic nucleus, which is usually hydrogen.
The acetaldehyde then reacts with the cyanide compound NH3+HCNN{H_3} + HCN to form the cyanide compound.
HCCH+H2OH2SO4HgSO4HCH=CHOH tautomerization CH3CHOHCNNH3CH3CH(CN)NH2H3O+CH3CH(COOH)NH2{\mathbf{H}} - {\mathbf{C}} \equiv {\mathbf{C}} - {\mathbf{H}} + {{\mathbf{H}}_2}{\text{O}}\xrightarrow[{{{\text{H}}_2}{\text{S}}{{\text{O}}_4}}]{{{\text{HgS}}{{\text{O}}_4}}}{\mathbf{H}} - {\mathbf{CH}} = {\mathbf{CH}} - {\text{OH}}\mathop {\xrightarrow{{{\text{ tautomerization }}}}}\limits^{} {\mathbf{C}}{{\mathbf{H}}_3} - {\mathbf{CHO}}\xrightarrow[{HCN}]{{N{H_3}}}C{H_3} - CH(CN) - N{H_2}\xrightarrow{{{H_3}{O^ + }}}C{H_3} - CH(COOH) - N{H_2}
This compound is then hydrolyzed, yielding alanine (alpha- amino acid) as a result.

A cyanide is a chemical compound with the CN group in its name. The cyano group is made up of a carbon atom that is triple-bonded to a nitrogen atom. The cyanide group is present as the anion CN in inorganic cyanides. Sodium cyanide and potassium cyanide are highly toxic soluble salts.
Hence the final answer is B. Alanine.

Note:
Pyruvate and branched chain amino acids including valine, leucine, and isoleucine can be used to make alanine.
The two-step mechanism of reductive amination of pyruvate produces alanine. Glutamate dehydrogenase converts -ketoglutarate, ammonia, and NADH to glutamate,NAD+NA{D^ + }, and water in the first phase. In the second step, an aminotransferase enzyme transfers the amino group of the newly formed glutamate to pyruvate, regenerating the alpha-ketoglutarate and transferring the pyruvate to alanine. As a result, pyruvate and ammonia are reduced to alanine, resulting in the consumption of one reducing counterpart.