Solveeit Logo

Question

Question: Calculate \[\Delta H_f^0\] of \[{C_6}{H_{12}}{O_6}\](s) from the following data: \[\Delta {H_{Comb...

Calculate ΔHf0\Delta H_f^0 of C6H12O6{C_6}{H_{12}}{O_6}(s) from the following data:
ΔHComb\Delta {H_{Comb}} of C6H12O6{C_6}{H_{12}}{O_6}(s) = -2816 KJ mol1mo{l^{ - 1}}, ΔHf0\Delta H_f^0 of CO2C{O_2}(g) = -393.5 KJ mol1mo{l^{ - 1}} and ΔHf0\Delta H_f^0 H2OH_2O= -285.9KJmol1mo{l^{ - 1}}.
A. 1260 KJmol1mo{l^{ - 1}}
B. -1260 KJmol1mo{l^{ - 1}}
C. -2260 KJmol1mo{l^{ - 1}}
D. -3260 KJ mol1mo{l^{ - 1}}

Explanation

Solution

To calculate the heat of formation Hess’s law of heat summation is applied where the heat evolved or released during the chemical reaction is calculated by summing the known value for heat of formation or combustion for each step.

Complete step by step answer:
Given,
ΔHComb\Delta {H_{Comb}} of C6H12O6{C_6}{H_{12}}{O_6}(s) = -2816 KJ mol1mo{l^{ - 1}}
ΔHf0\Delta H_f^0 of CO2C{O_2}(g) = -393.5 KJ mol1mo{l^{ - 1}}
ΔHf0\Delta H_f^0 H2OH_2O= -285.9KJmol1mo{l^{ - 1}}.
The reaction for the combustion of one mole glucose is shown below.
C6H12O6(s)+6O2(g)6CO2(g)+6H2O(l){C_6}{H_{12}}{O_6}(s) + 6{O_2}(g) \to 6C{O_2}(g) + 6{H_2}O(l)
In this reaction, one mole of glucose reacts with six mole of oxygen to form 6 mole of carbon dioxide and six mole of water.
The heat of formation is also known as standard heat of formation, enthalpy of formation and standard enthalpy of formation.
The enthalpy of formation is defined as the amount of heat released or absorbed in the formation of one mole of compound from its constituent elements where the elements are present in their normal standard state.
By using Hess’s law of heat summation, the heat evolved or released during the chemical reaction is calculated by summing the known value for heat of formation or combustion for each step.
The enthalpy of formation for glucose is calculated as shown below.
ΔHf  of  C6H12O6\Delta {H_f}\;of\;{C_6}{H_{12}}{O_6}=6×ΔHfof  CO2+6×ΔHfof  H2OΔHcombusof  C6H12O66 \times \Delta {H_f} of\;C{O_2} + 6 \times \Delta {H_f} of\;{H_2}O - \Delta {H_{combus}} of\;{C_6}{H_{12}}{O_6}
To calculate the enthalpy of formation for glucose, substitute the values in above expression as shown below.
ΔHf  of  C6H12O6\Delta {H_f}\;of\;{C_6}{H_{12}}{O_6}=6×(393.5)+6×(285.9)(2816)6 \times ( - 393.5) + 6 \times ( - 285.9) - ( - 2816)
ΔHf  of  C6H12O6\Delta {H_f}\;of\;{C_6}{H_{12}}{O_6}=-1260 KJ mol1mo{l^{ - 1}}
Thus, the heat of formation of glucose is -1260 KJ mol1mo{l^{ - 1}}.
Therefore, the correct option is B.

Note:
The enthalpy change in a chemical process or physical process is the same, whether the whole process took place in one step or more than one step. The standard enthalpy of the reaction is calculated by subtracting the sum of the standard enthalpy formation of the product with the sum of the standard enthalpy formation of the reactants.