Solveeit Logo

Question

Question: Balance the following equation in basic medium by ion-electron method and oxidation number method an...

Balance the following equation in basic medium by ion-electron method and oxidation number method and identify the oxidizing agent and the reducing agent.
P4(s)+OH(aq)PH3(g)+H2PO2(aq){{\text{P}}_{4\left( {\text{s}} \right)}} + {\text{O}}{{\text{H}}^ - }_{\left( {{\text{aq}}} \right)} \to {\text{P}}{{\text{H}}_{3\left( {\text{g}} \right)}} + {{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}}

Explanation

Solution

Oxidation is the loss of electrons and reduction is the gain of electrons. It can be determined by two methods-ion electron method and oxidation number method. The Ion-electron method is also known as the half-reaction method. Oxidation number is a positive or negative number assigned to an atom to indicate its degree of oxidation or reduction.

Complete step by step answer:
In the ion-electron method, the reaction is divided into two halves-oxidation half and reduction half.
Oxidation half reaction: P4(s)H2PO2(aq){{\text{P}}_{4\left( {\text{s}} \right)}} \to {{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}}
P{\text{P}} atom can be balanced by P4(s)4H2PO2(aq){{\text{P}}_{4\left( {\text{s}} \right)}} \to 4{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}}
The oxidation number is not balanced. It can be balanced by adding 4e4{{\text{e}}^ - } in the products.
i.e. P4(s)4H2PO2(aq)+4e{{\text{P}}_{4\left( {\text{s}} \right)}} \to 4{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}} + 4{{\text{e}}^ - }
The charge is still not balanced. There is no oxygen and hydrogen in LHS. Thus we have to add eight hydroxide ions on the reactant side.
P4(s)+8OH+8H+4H2PO2(aq)+4e P4(s)+8H2O4H2PO2(aq)+4e+8H+ {{\text{P}}_{4\left( {\text{s}} \right)}} + 8{\text{O}}{{\text{H}}^ - } + 8{{\text{H}}^ + } \to 4{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}} + 4{{\text{e}}^ - } \\\ {{\text{P}}_{4\left( {\text{s}} \right)}} + 8{{\text{H}}_2}{\text{O}} \to 4{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}} + 4{{\text{e}}^ - } + 8{{\text{H}}^ + } \\\
Now the oxidation half is balanced.
Reduction half reaction: P4(s)PH3(g){{\text{P}}_{4\left( {\text{s}} \right)}} \to {\text{P}}{{\text{H}}_{3\left( {\text{g}} \right)}}
Since there is a transfer of three electrons and there are four P{\text{P}} atoms, there is an addition of a total twelve electrons. Thus the reaction becomes P4(s)+12ePH3(g){{\text{P}}_{4\left( {\text{s}} \right)}} + 12{{\text{e}}^ - } \to {\text{P}}{{\text{H}}_{3\left( {\text{g}} \right)}}
The charge is balanced by adding 12OH12{\text{O}}{{\text{H}}^ - } ions.
P4(s)+12e+12H+PH3(g)+12OH{{\text{P}}_{4\left( {\text{s}} \right)}} + 12{{\text{e}}^ - } + 12{{\text{H}}^ + } \to {\text{P}}{{\text{H}}_{3\left( {\text{g}} \right)}} + 12{\text{O}}{{\text{H}}^ - }
Now the reduction half is balanced.
Oxidation half: P4(s)+8OH4H2PO2(aq)+4e+8H+(1){{\text{P}}_{4\left( {\text{s}} \right)}} + 8{\text{O}}{{\text{H}}^ - } \to 4{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}} + 4{{\text{e}}^ - } + 8{{\text{H}}^ + } \to \left( 1 \right)
Reduction half: P4(s)+12ePH3(g)+12OH(2){{\text{P}}_{4\left( {\text{s}} \right)}} + 12{{\text{e}}^ - } \to {\text{P}}{{\text{H}}_{3\left( {\text{g}} \right)}} + 12{\text{O}}{{\text{H}}^ - } \to \left( 2 \right)
To balance, we have to multiply (1)\left( 1 \right) with 33 and add with (2)\left( 2 \right)
(1)\left( 1 \right) becomes 3P4(s)+12OH12H2PO2(aq)+12e{\text{3}}{{\text{P}}_{4\left( {\text{s}} \right)}} + 12{\text{O}}{{\text{H}}^ - } \to 12{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}} + 12{{\text{e}}^ - } which is added with (2)\left( 2 \right), we get
4P4(s)+24H2O + 12OH4PH3+12H2PO2(aq)+12H++12OH{\text{4}}{{\text{P}}_{4\left( {\text{s}} \right)}} + 24{{\text{H}}_2}{\text{O + }}12{\text{O}}{{\text{H}}^ - } \to 4{\text{P}}{{\text{H}}_3} + 12{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}} + 12{{\text{H}}^ + } + 12{\text{O}}{{\text{H}}^ - }
On further simplification, we get
{\text{4}}{{\text{P}}_{4\left( {\text{s}} \right)}} + 24{{\text{H}}_2}{\text{O + }}12{\text{O}}{{\text{H}}^ - } \to 4{\text{P}}{{\text{H}}_3} + 12{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}} + 12{{\text{H}}_2}{\text{O}} \\\ {\text{4}}{{\text{P}}_{4\left( {\text{s}} \right)}} + 12{{\text{H}}_2}{\text{O + }}12{\text{O}}{{\text{H}}^ - } \to 4{\text{P}}{{\text{H}}_3} + 12{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}} \\\
Simplifying,
P4(s)+3H2O + 3OHPH3+3H2PO2(aq){{\text{P}}_{4\left( {\text{s}} \right)}} + 3{{\text{H}}_2}{\text{O + 3O}}{{\text{H}}^ - } \to {\text{P}}{{\text{H}}_3} + 3{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}}
Thus the balanced chemical equation is obtained.
In the oxidation number method, oxidation and reduction depend upon the oxidation number. When the oxidation number is increased, then the element is called oxidizing agent and when the oxidation number is decreased, then the element is called reducing agent.
Oxidation numbers are assigned to each element.
P4(s)+OH(aq)PH3(g)+H2PO2(aq){{\text{P}}_{4\left( {\text{s}} \right)}} + {\text{O}}{{\text{H}}^ - }_{\left( {{\text{aq}}} \right)} \to {\text{P}}{{\text{H}}_{3\left( {\text{g}} \right)}} + {{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}}
00 3 - 3 +2 + 2
P4{{\text{P}}_4} acts as both oxidizing agent and reducing agent. When P{\text{P}} has increased its oxidation number, there is a total increase of 44. When P{\text{P}} has decreased its oxidation number, there is a total decrease of 1212. Thus there is a difference of three. Thus H2PO2{{\text{H}}_2}{\text{P}}{{\text{O}}_2}^ - is multiplied by 33. Thus the equation becomes:
P4(s)+OH(aq)PH3(g)+3H2PO2(aq){{\text{P}}_{4\left( {\text{s}} \right)}} + {\text{O}}{{\text{H}}^ - }_{\left( {{\text{aq}}} \right)} \to {\text{P}}{{\text{H}}_{3\left( {\text{g}} \right)}} + 3{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}}
Now we have to balance oxygen atoms. There are six oxygen in RHS, thus multiplying OH{\text{O}}{{\text{H}}^ - } with six, we get P4(s)+6OH(aq)PH3(g)+3H2PO2(aq){{\text{P}}_{4\left( {\text{s}} \right)}} + 6{\text{O}}{{\text{H}}^ - }_{\left( {{\text{aq}}} \right)} \to {\text{P}}{{\text{H}}_{3\left( {\text{g}} \right)}} + 3{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}}
33 water molecules are added to LHS and 33 OH{\text{O}}{{\text{H}}^ - } ions are added to RHS.
i.e. P4(s)+6OH(aq)+3H2OPH3(g)+3H2PO2(aq)+3OH(aq){{\text{P}}_{4\left( {\text{s}} \right)}} + 6{\text{O}}{{\text{H}}^ - }_{\left( {{\text{aq}}} \right)} + 3{{\text{H}}_2}{\text{O}} \to {\text{P}}{{\text{H}}_{3\left( {\text{g}} \right)}} + 3{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}} + 3{\text{O}}{{\text{H}}^ - }_{\left( {{\text{aq}}} \right)}
Simplifying, P4(s)+3OH(aq)+3H2OPH3(g)+3H2PO2(aq){{\text{P}}_{4\left( {\text{s}} \right)}} + 3{\text{O}}{{\text{H}}^ - }_{\left( {{\text{aq}}} \right)} + 3{{\text{H}}_2}{\text{O}} \to {\text{P}}{{\text{H}}_{3\left( {\text{g}} \right)}} + 3{{\text{H}}_2}{\text{P}}{{\text{O}}_2}{^ - _{\left( {{\text{aq}}} \right)}}
Thus the chemical equation is balanced.

Note:
Rules for assigning oxidation number are:
Oxidation number of any uncombined element is 00.
Oxidation number of a monatomic ion equals the charge on the ion.
Oxygen has an oxidation number 2 - 2 unless it is combined with fluorine, peroxide.
The sum of the oxidation numbers of all atoms in a neutral compound is 00.
The sum of the oxidation numbers of all atoms in a polyatomic ion equals the charge on the ion.